C25H17N3O4 — CID 98120956
2-[(3R,4S)-3-(2-nitrophenyl)-4-phenyl-3,4-dihydropyridazin-6-yl]indene-1,3-dione (PubChem CID 98120956) has the molecular formula C25H17N3O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-[(3R,4S)-3-(2-nitrophenyl)-4-phenyl-3,4-dihydropyridazin-6-yl]indene-1,3-dione.
| Compound Name | 2-[(3R,4S)-3-(2-nitrophenyl)-4-phenyl-3,4-dihydropyridazin-6-yl]indene-1,3-dione |
|---|---|
| PubChem CID | 98120956 |
| Molecular Formula | C25H17N3O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[(3R,4S)-3-(2-nitrophenyl)-4-phenyl-3,4-dihydropyridazin-6-yl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1C1=C[C@@H](c2ccccc2)[C@H](c2ccccc2[N+](=O)[O-])N=N1 |
| InChI | InChI=1S/C25H17N3O4/c29-24-16-10-4-5-11-17(16)25(30)22(24)20-14-19(15-8-2-1-3-9-15)23(27-26-20)18-12-6-7-13-21(18)28(31)32/h1-14,19,22-23H/t19-,23-/m0/s1 |
| InChIKey | RXFMBVTZQDMTSR-CVDCTZTESA-N |
| XLogP | 5.46 |
| TPSA | 102.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|