C64H58N6O4 — CID 91152818
5-N,5-N,15-N,15-N-tetrakis[(4-methoxyphenyl)methyl]-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5,15-diamine (PubChem CID 91152818) has the molecular formula C64H58N6O4 and a molecular weight of 975.21 g/mol. Its IUPAC name is 5-N,5-N,15-N,15-N-tetrakis[(4-methoxyphenyl)methyl]-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5,15-diamine.
| Compound Name | 5-N,5-N,15-N,15-N-tetrakis[(4-methoxyphenyl)methyl]-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5,15-diamine |
|---|---|
| PubChem CID | 91152818 |
| Molecular Formula | C64H58N6O4 |
| Molecular Weight | 975.21 g/mol |
| Exact Mass | 974.45 |
| IUPAC Name | 5-N,5-N,15-N,15-N-tetrakis[(4-methoxyphenyl)methyl]-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5,15-diamine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(N(Cc3ccc(OC)cc3)Cc3ccc(OC)cc3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C64H58N6O4/c1-71-49-23-15-43(16-24-49)39-69(40-44-17-25-50(72-2)26-18-44)63-57-35-31-53(65-57)61(47-11-7-5-8-12-47)55-33-37-59(67-55)64(60-38-34-56(68-60)62(48-13-9-6-10-14-48)54-32-36-58(63)66-54)70(41-45-19-27-51(73-3)28-20-45)42-46-21-29-52(74-4)30-22-46/h5-38,65-68H,39-42H2,1-4H3 |
| InChIKey | HPIFMRGAKVBAFJ-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.21 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |