C51H47N5O4Si — CID 123343562
N-(3-trimethoxysilylpropyl)-4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzamide (PubChem CID 123343562) has the molecular formula C51H47N5O4Si and a molecular weight of 822.05 g/mol. Its IUPAC name is N-(3-trimethoxysilylpropyl)-4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzamide.
| Compound Name | N-(3-trimethoxysilylpropyl)-4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzamide |
|---|---|
| PubChem CID | 123343562 |
| Molecular Formula | C51H47N5O4Si |
| Molecular Weight | 822.05 g/mol |
| Exact Mass | 821.34 |
| IUPAC Name | N-(3-trimethoxysilylpropyl)-4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzamide |
| SMILES | CO[Si](CCCNC(=O)c1ccc(C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(c3ccccc3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)cc1)(OC)OC |
| InChI | InChI=1S/C51H47N5O4Si/c1-58-61(59-2,60-3)33-13-32-52-51(57)38-22-20-37(21-23-38)50-45-30-28-43(55-45)48(35-16-9-5-10-17-35)41-26-24-39(53-41)47(34-14-7-4-8-15-34)40-25-27-42(54-40)49(36-18-11-6-12-19-36)44-29-31-46(50)56-44/h4-12,14-31,53-56H,13,32-33H2,1-3H3,(H,52,57) |
| InChIKey | PMKOPZIKXRTGPV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.05 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|