C54H45N5O4Si — CID 123608768
N-(4-trimethoxysilylphenyl)-4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzamide (PubChem CID 123608768) has the molecular formula C54H45N5O4Si and a molecular weight of 856.07 g/mol. Its IUPAC name is N-(4-trimethoxysilylphenyl)-4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzamide.
| Compound Name | N-(4-trimethoxysilylphenyl)-4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzamide |
|---|---|
| PubChem CID | 123608768 |
| Molecular Formula | C54H45N5O4Si |
| Molecular Weight | 856.07 g/mol |
| Exact Mass | 855.32 |
| IUPAC Name | N-(4-trimethoxysilylphenyl)-4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzamide |
| SMILES | CO[Si](OC)(OC)c1ccc(NC(=O)c2ccc(C3=c4ccc([nH]4)=C(c4ccccc4)c4ccc([nH]4)C(c4ccccc4)=c4ccc([nH]4)=C(c4ccccc4)c4ccc3[nH]4)cc2)cc1 |
| InChI | InChI=1S/C54H45N5O4Si/c1-61-64(62-2,63-3)41-25-23-40(24-26-41)55-54(60)39-21-19-38(20-22-39)53-48-33-31-46(58-48)51(36-15-9-5-10-16-36)44-29-27-42(56-44)50(35-13-7-4-8-14-35)43-28-30-45(57-43)52(37-17-11-6-12-18-37)47-32-34-49(53)59-47/h4-34,56-59H,1-3H3,(H,55,60) |
| InChIKey | SZQINXYIYWRJOS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.07 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|