C16H24N6O5Si — CID 59153820
3-N-phenyl-6-N-(3-trimethoxysilylpropyl)-1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxamide (PubChem CID 59153820) has the molecular formula C16H24N6O5Si and a molecular weight of 408.49 g/mol. Its IUPAC name is 3-N-phenyl-6-N-(3-trimethoxysilylpropyl)-1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxamide.
| Compound Name | 3-N-phenyl-6-N-(3-trimethoxysilylpropyl)-1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 59153820 |
| Molecular Formula | C16H24N6O5Si |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 3-N-phenyl-6-N-(3-trimethoxysilylpropyl)-1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxamide |
| SMILES | CO[Si](CCCNC(=O)C1=NNC(C(=O)Nc2ccccc2)=NN1)(OC)OC |
| InChI | InChI=1S/C16H24N6O5Si/c1-25-28(26-2,27-3)11-7-10-17-15(23)13-19-21-14(22-20-13)16(24)18-12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3,(H,17,23)(H,18,24)(H,19,20)(H,21,22) |
| InChIKey | APWJYASNDRRDLA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 134.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|