C52H32N4 — CID 91566904
5,10,15,20-tetrakis(2-phenylethynyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91566904) has the molecular formula C52H32N4 and a molecular weight of 712.86 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2-phenylethynyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2-phenylethynyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91566904 |
| Molecular Formula | C52H32N4 |
| Molecular Weight | 712.86 g/mol |
| Exact Mass | 712.26 |
| IUPAC Name | 5,10,15,20-tetrakis(2-phenylethynyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | C(#Cc1ccccc1)C1=c2ccc([nH]2)=C(C#Cc2ccccc2)c2ccc([nH]2)C(C#Cc2ccccc2)=c2ccc([nH]2)=C(C#Cc2ccccc2)c2ccc1[nH]2 |
| InChI | InChI=1S/C52H32N4/c1-5-13-37(14-6-1)21-25-41-45-29-31-47(53-45)42(26-22-38-15-7-2-8-16-38)49-33-35-51(55-49)44(28-24-40-19-11-4-12-20-40)52-36-34-50(56-52)43(48-32-30-46(41)54-48)27-23-39-17-9-3-10-18-39/h1-20,29-36,53-56H |
| InChIKey | KGJIZUQZQHNECW-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.86 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|