C33H28N4 — CID 163986385
(1Z,14Z,17Z)-16-methyl-2,12-diphenyl-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1,3,5,7,9,11,14,17,19-nonaen-13-imine (PubChem CID 163986385) has the molecular formula C33H28N4 and a molecular weight of 480.62 g/mol. Its IUPAC name is (1Z,14Z,17Z)-16-methyl-2,12-diphenyl-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1,3,5,7,9,11,14,17,19-nonaen-13-imine.
| Compound Name | (1Z,14Z,17Z)-16-methyl-2,12-diphenyl-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1,3,5,7,9,11,14,17,19-nonaen-13-imine |
|---|---|
| PubChem CID | 163986385 |
| Molecular Formula | C33H28N4 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (1Z,14Z,17Z)-16-methyl-2,12-diphenyl-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1,3,5,7,9,11,14,17,19-nonaen-13-imine |
| SMILES | [H]/N=C1/C=C\C(C)/C=c2/cc/c([nH]2)=C(\c2ccccc2)c2ccc([nH]2)C=c2ccc([nH]2)=C1c1ccccc1 |
| InChI | InChI=1S/C33H28N4/c1-22-12-16-28(34)32(23-8-4-2-5-9-23)29-17-14-26(36-29)21-27-15-19-31(37-27)33(24-10-6-3-7-11-24)30-18-13-25(20-22)35-30/h2-22,34-37H,1H3/b16-12-,25-20-,26-21?,32-29?,33-30-,34-28- |
| InChIKey | DZKYLEFKUABAPA-MGBFXWGKSA-N |
| XLogP | 3.95 |
| TPSA | 71.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|