C29H26N4 — CID 91454171
2,12-dimethyl-5-(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91454171) has the molecular formula C29H26N4 and a molecular weight of 430.56 g/mol. Its IUPAC name is 2,12-dimethyl-5-(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 2,12-dimethyl-5-(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91454171 |
| Molecular Formula | C29H26N4 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2,12-dimethyl-5-(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | Cc1ccc(C2=c3cc(C)c([nH]3)=Cc3ccc([nH]3)C=c3cc(C)c([nH]3)=Cc3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C29H26N4/c1-17-4-6-20(7-5-17)29-25-11-10-23(31-25)16-26-18(2)12-24(32-26)14-21-8-9-22(30-21)15-27-19(3)13-28(29)33-27/h4-16,30-33H,1-3H3 |
| InChIKey | DUYACRBGTYPNFC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |