C44H40N4O — CID 91332734
3,3-dimethyl-10-(4-methylphenyl)-20-phenyl-15-(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-2-one (PubChem CID 91332734) has the molecular formula C44H40N4O and a molecular weight of 640.83 g/mol. Its IUPAC name is 3,3-dimethyl-10-(4-methylphenyl)-20-phenyl-15-(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-2-one.
| Compound Name | 3,3-dimethyl-10-(4-methylphenyl)-20-phenyl-15-(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-2-one |
|---|---|
| PubChem CID | 91332734 |
| Molecular Formula | C44H40N4O |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.32 |
| IUPAC Name | 3,3-dimethyl-10-(4-methylphenyl)-20-phenyl-15-(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-2-one |
| SMILES | Cc1ccc(C2=c3ccc([nH]3)=C(c3c(C)cc(C)cc3C)c3ccc([nH]3)C(c3ccccc3)=C3NC(=Cc4ccc2[nH]4)C(C)(C)C3=O)cc1 |
| InChI | InChI=1S/C44H40N4O/c1-25-12-14-30(15-13-25)39-32-17-16-31(45-32)24-37-44(5,6)43(49)42(48-37)40(29-10-8-7-9-11-29)34-19-21-36(47-34)41(35-20-18-33(39)46-35)38-27(3)22-26(2)23-28(38)4/h7-24,45-48H,1-6H3 |
| InChIKey | YBRQYHOOHYHOCZ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |