C34H30N4O3 — CID 91124119
15-[4-(hydroxymethyl)phenyl]-5-(4-methylphenyl)-2,3,21,22,23,24-hexahydroporphyrin-2,3-diol (PubChem CID 91124119) has the molecular formula C34H30N4O3 and a molecular weight of 542.64 g/mol. Its IUPAC name is 15-[4-(hydroxymethyl)phenyl]-5-(4-methylphenyl)-2,3,21,22,23,24-hexahydroporphyrin-2,3-diol.
| Compound Name | 15-[4-(hydroxymethyl)phenyl]-5-(4-methylphenyl)-2,3,21,22,23,24-hexahydroporphyrin-2,3-diol |
|---|---|
| PubChem CID | 91124119 |
| Molecular Formula | C34H30N4O3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 15-[4-(hydroxymethyl)phenyl]-5-(4-methylphenyl)-2,3,21,22,23,24-hexahydroporphyrin-2,3-diol |
| SMILES | Cc1ccc(C2=C3NC(=Cc4ccc([nH]4)C(c4ccc(CO)cc4)=c4ccc([nH]4)=Cc4ccc2[nH]4)C(O)C3O)cc1 |
| InChI | InChI=1S/C34H30N4O3/c1-19-2-6-22(7-3-19)31-28-15-11-24(36-28)16-23-10-13-26(35-23)30(21-8-4-20(18-39)5-9-21)27-14-12-25(37-27)17-29-33(40)34(41)32(31)38-29/h2-17,33-41H,18H2,1H3 |
| InChIKey | OPQNZMPCETXQDZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |