C36H32N4O2 — CID 101267150
(5Z,9Z,15Z,19Z)-5,15-bis[2-(methoxymethyl)phenyl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 101267150) has the molecular formula C36H32N4O2 and a molecular weight of 552.68 g/mol. Its IUPAC name is (5Z,9Z,15Z,19Z)-5,15-bis[2-(methoxymethyl)phenyl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | (5Z,9Z,15Z,19Z)-5,15-bis[2-(methoxymethyl)phenyl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 101267150 |
| Molecular Formula | C36H32N4O2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (5Z,9Z,15Z,19Z)-5,15-bis[2-(methoxymethyl)phenyl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | COCc1ccccc1/C1=c2\cc/c([nH]2)=C/c2ccc([nH]2)/C(c2ccccc2COC)=c2/cc/c([nH]2)=C/c2ccc1[nH]2 |
| InChI | InChI=1S/C36H32N4O2/c1-41-21-23-7-3-5-9-29(23)35-31-15-11-25(37-31)19-27-13-17-33(39-27)36(30-10-6-4-8-24(30)22-42-2)34-18-14-28(40-34)20-26-12-16-32(35)38-26/h3-20,37-40H,21-22H2,1-2H3/b25-19-,26-20-,27-19-,28-20-,35-31-,35-32-,36-33-,36-34- |
| InChIKey | VJISLWGQKWPBQY-FPYNEFEXSA-N |
| XLogP | 3.76 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |