C21H20N4 — CID 123790072
2,17-dimethyl-21,22,23,24-tetrahydro-2H-corrin (PubChem CID 123790072) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2,17-dimethyl-21,22,23,24-tetrahydro-2H-corrin.
| Compound Name | 2,17-dimethyl-21,22,23,24-tetrahydro-2H-corrin |
|---|---|
| PubChem CID | 123790072 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2,17-dimethyl-21,22,23,24-tetrahydro-2H-corrin |
| SMILES | Cc1cc2[nH]c1=Cc1ccc([nH]1)C=c1ccc([nH]1)=CC1=CC(C)C=2N1 |
| InChI | InChI=1S/C21H20N4/c1-12-8-20-21-13(2)7-18(24-21)10-16-4-3-14(22-16)9-15-5-6-17(23-15)11-19(12)25-20/h3-11,13,22-25H,1-2H3 |
| InChIKey | ZPBPAOLYFBOEDU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |