C22H20N4 — CID 139592499
(1Z,9Z,13Z,19Z)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene (PubChem CID 139592499) has the molecular formula C22H20N4 and a molecular weight of 340.43 g/mol. Its IUPAC name is (1Z,9Z,13Z,19Z)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene.
| Compound Name | (1Z,9Z,13Z,19Z)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 139592499 |
| Molecular Formula | C22H20N4 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (1Z,9Z,13Z,19Z)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene |
| SMILES | C1=C2/CC/C(=C3\CCc4cc([nH]c43)/C=c3/cc/c([nH]3)=C/c3ccc/1[nH]3)N2 |
| InChI | InChI=1S/C22H20N4/c1-7-20-21-8-6-18(25-21)11-16-3-2-14(23-16)10-15-4-5-17(24-15)12-19-9-13(1)22(20)26-19/h2-5,9-12,23-26H,1,6-8H2/b15-10-,17-12-,18-11-,21-20- |
| InChIKey | WRURTWIFRXGTEP-UXHRNZQSSA-N |
| XLogP | 2.72 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |