C20H16N6 — CID 154020327
22,24-dihydro-21H-porphyrin-2-ylidenehydrazine (PubChem CID 154020327) has the molecular formula C20H16N6 and a molecular weight of 340.39 g/mol. Its IUPAC name is 22,24-dihydro-21H-porphyrin-2-ylidenehydrazine.
| Compound Name | 22,24-dihydro-21H-porphyrin-2-ylidenehydrazine |
|---|---|
| PubChem CID | 154020327 |
| Molecular Formula | C20H16N6 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 22,24-dihydro-21H-porphyrin-2-ylidenehydrazine |
| SMILES | NN=C1C=C2/C=c3/cc/c([nH]3)=C/C3=N/C(=C\c4ccc([nH]4)/C=C/1N2)C=C3 |
| InChI | InChI=1S/C20H16N6/c21-26-20-11-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)10-19(20)25-18/h1-11,23-25H,21H2/b13-8-,14-7-,16-9-,19-10-,26-20? |
| InChIKey | ZJFVEKOINOLQLZ-MBTPVYJGSA-N |
| XLogP | 1.11 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|