C20H15FN4 — CID 154001382
1-fluoro-21,23-dihydro-2H-porphyrin (PubChem CID 154001382) has the molecular formula C20H15FN4 and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-fluoro-21,23-dihydro-2H-porphyrin.
| Compound Name | 1-fluoro-21,23-dihydro-2H-porphyrin |
|---|---|
| PubChem CID | 154001382 |
| Molecular Formula | C20H15FN4 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-fluoro-21,23-dihydro-2H-porphyrin |
| SMILES | FC12C=C3C=CC(=N3)C=c3ccc([nH]3)=CC3=NC(=CC(=CC1)N2)C=C3 |
| InChI | InChI=1S/C20H15FN4/c21-20-8-7-18(25-20)11-17-4-3-14(23-17)9-13-1-2-15(22-13)10-16-5-6-19(12-20)24-16/h1-7,9-12,22,25H,8H2 |
| InChIKey | ZJCUGYRZSUUART-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|