C44H30N4O — CID 175043440
23-oxido-10,12,13,23-tetraphenyl-21H-porphyrin-23-ium (PubChem CID 175043440) has the molecular formula C44H30N4O and a molecular weight of 630.75 g/mol. Its IUPAC name is 23-oxido-10,12,13,23-tetraphenyl-21H-porphyrin-23-ium.
| Compound Name | 23-oxido-10,12,13,23-tetraphenyl-21H-porphyrin-23-ium |
|---|---|
| PubChem CID | 175043440 |
| Molecular Formula | C44H30N4O |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | 23-oxido-10,12,13,23-tetraphenyl-21H-porphyrin-23-ium |
| SMILES | [O-][N+]1(c2ccccc2)C2=C(c3ccccc3)C(c3ccccc3)=C1/C(c1ccccc1)=C1/C=CC(=N1)/C=c1/cc/c([nH]1)=C/C1=N/C(=C\2)C=C1 |
| InChI | InChI=1S/C44H30N4O/c49-48(38-19-11-4-12-20-38)40-29-37-24-23-34(46-37)27-33-21-22-35(45-33)28-36-25-26-39(47-36)41(30-13-5-1-6-14-30)44(48)43(32-17-9-3-10-18-32)42(40)31-15-7-2-8-16-31/h1-29,45H/b33-27-,34-27-,35-28-,36-28-,37-29-,40-29-,41-39-,44-41- |
| InChIKey | AXSBPNCCFLAQCL-FCSWOMCQSA-N |
| XLogP | 8.25 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|