C44H31N4+ — CID 54125543
10,15,22,22-tetraphenyl-21H-porphyrin-22-ium (PubChem CID 54125543) has the molecular formula C44H31N4+ and a molecular weight of 615.76 g/mol. Its IUPAC name is 10,15,22,22-tetraphenyl-21H-porphyrin-22-ium.
| Compound Name | 10,15,22,22-tetraphenyl-21H-porphyrin-22-ium |
|---|---|
| PubChem CID | 54125543 |
| Molecular Formula | C44H31N4+ |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 10,15,22,22-tetraphenyl-21H-porphyrin-22-ium |
| SMILES | C1=C/C2=C(\c3ccccc3)C3=N/C(=C(/c4ccccc4)C4=CC=C(/C=c5/cc/c([nH]5)=C/C1=N2)[N+]4(c1ccccc1)c1ccccc1)C=C3 |
| InChI | InChI=1S/C44H31N4/c1-5-13-31(14-6-1)43-39-25-23-34(46-39)29-33-21-22-35(45-33)30-38-24-28-42(44(32-15-7-2-8-16-32)41-27-26-40(43)47-41)48(38,36-17-9-3-10-18-36)37-19-11-4-12-20-37/h1-30,45H/q+1/b33-29-,34-29-,35-30-,38-30-,43-39-,43-40-,44-41-,44-42- |
| InChIKey | CHIAWZUQELUVKB-KJNRISHFSA-N |
| XLogP | 8.55 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|