C31H28N4OSi — CID 141175488
4-[(5Z,10Z,14Z,19Z)-5-(2-trimethylsilylethynyl)-21,23-dihydro-2H-porphyrin-1-yl]phenol (PubChem CID 141175488) has the molecular formula C31H28N4OSi and a molecular weight of 500.68 g/mol. Its IUPAC name is 4-[(5Z,10Z,14Z,19Z)-5-(2-trimethylsilylethynyl)-21,23-dihydro-2H-porphyrin-1-yl]phenol.
| Compound Name | 4-[(5Z,10Z,14Z,19Z)-5-(2-trimethylsilylethynyl)-21,23-dihydro-2H-porphyrin-1-yl]phenol |
|---|---|
| PubChem CID | 141175488 |
| Molecular Formula | C31H28N4OSi |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-[(5Z,10Z,14Z,19Z)-5-(2-trimethylsilylethynyl)-21,23-dihydro-2H-porphyrin-1-yl]phenol |
| SMILES | C[Si](C)(C)C#C/C1=C2\C=CC(=N2)/C=c2/cc/c([nH]2)=C/C2=N/C(=C\C3(c4ccc(O)cc4)CC=C1N3)C=C2 |
| InChI | InChI=1S/C31H28N4OSi/c1-37(2,3)17-15-28-29-13-10-25(34-29)19-23-7-6-22(32-23)18-24-8-9-26(33-24)20-31(16-14-30(28)35-31)21-4-11-27(36)12-5-21/h4-14,18-20,32,35-36H,16H2,1-3H3/b22-18-,23-19-,26-20-,29-28- |
| InChIKey | NWPSQFZFNANIRK-FMGZWCIJSA-N |
| XLogP | 4.11 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|