C23H21N7 — CID 91057941
1,8,11,23,27,28,30-heptazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,9,12,14,16,18(27),19,21,24-undecaene (PubChem CID 91057941) has the molecular formula C23H21N7 and a molecular weight of 395.47 g/mol. Its IUPAC name is 1,8,11,23,27,28,30-heptazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,9,12,14,16,18(27),19,21,24-undecaene.
| Compound Name | 1,8,11,23,27,28,30-heptazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,9,12,14,16,18(27),19,21,24-undecaene |
|---|---|
| PubChem CID | 91057941 |
| Molecular Formula | C23H21N7 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1,8,11,23,27,28,30-heptazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,9,12,14,16,18(27),19,21,24-undecaene |
| SMILES | C1=CC2=NC1=CN1C=CN(C=c3ccc([nH]3)=CN3C=CN(C=c4ccc([nH]4)=C2)C3)C1 |
| InChI | InChI=1S/C23H21N7/c1-3-20-12-27-7-9-29(16-27)14-22-5-6-23(26-22)15-30-10-8-28(17-30)13-21-4-2-19(25-21)11-18(1)24-20/h1-15,24,26H,16-17H2 |
| InChIKey | MBHOXNTZLPEHSX-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |