C20H18N4O — CID 150231789
6,7,8,9,22,24-hexahydroporphyrin-2-ol (PubChem CID 150231789) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 6,7,8,9,22,24-hexahydroporphyrin-2-ol.
| Compound Name | 6,7,8,9,22,24-hexahydroporphyrin-2-ol |
|---|---|
| PubChem CID | 150231789 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6,7,8,9,22,24-hexahydroporphyrin-2-ol |
| SMILES | OC1=CC2=CC3CCC(C=C4C=CC(=N4)C=c4ccc([nH]4)=CC1=N2)N3 |
| InChI | InChI=1S/C20H18N4O/c25-20-11-18-9-16-4-3-14(22-16)7-12-1-2-13(21-12)8-15-5-6-17(23-15)10-19(20)24-18/h1-2,5-11,14,16,22-23,25H,3-4H2 |
| InChIKey | FVQHLSCGOYPWGO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |