C22H20N4OS — CID 152672691
6-methoxy-5-methylsulfanyl-21,24-dihydro-5H-porphyrin (PubChem CID 152672691) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is 6-methoxy-5-methylsulfanyl-21,24-dihydro-5H-porphyrin.
| Compound Name | 6-methoxy-5-methylsulfanyl-21,24-dihydro-5H-porphyrin |
|---|---|
| PubChem CID | 152672691 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 6-methoxy-5-methylsulfanyl-21,24-dihydro-5H-porphyrin |
| SMILES | COC12C=CC(=N1)C=C1C=CC(=N1)C=c1ccc([nH]1)=Cc1ccc([nH]1)C2SC |
| InChI | InChI=1S/C22H20N4OS/c1-27-22-10-9-19(26-22)13-17-6-5-15(24-17)11-14-3-4-16(23-14)12-18-7-8-20(25-18)21(22)28-2/h3-13,21,23,25H,1-2H3 |
| InChIKey | VQXZHPIDTRIBLE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |