C21H16N4O — CID 152655159
3-methyl-21,23-dihydro-1H-porphyrin-2-one (PubChem CID 152655159) has the molecular formula C21H16N4O and a molecular weight of 340.39 g/mol. Its IUPAC name is 3-methyl-21,23-dihydro-1H-porphyrin-2-one.
| Compound Name | 3-methyl-21,23-dihydro-1H-porphyrin-2-one |
|---|---|
| PubChem CID | 152655159 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-methyl-21,23-dihydro-1H-porphyrin-2-one |
| SMILES | CC1=C2C=C3C=CC(=N3)C=c3ccc([nH]3)=CC3=NC(=CC(N2)C1=O)C=C3 |
| InChI | InChI=1S/C21H16N4O/c1-12-19-10-17-6-4-15(23-17)8-13-2-3-14(22-13)9-16-5-7-18(24-16)11-20(25-19)21(12)26/h2-11,20,22,25H,1H3 |
| InChIKey | ZIJLZCSHSOAZFC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |