About 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol
2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol (PubChem CID 161096092) has the molecular formula C20H19N3O9
and a molecular weight of 445.38 g/mol. Its IUPAC name is 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol.
Molecular Properties
| Compound Name | 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol |
| PubChem CID | 161096092 |
| Molecular Formula | C20H19N3O9 |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol |
| SMILES | Cc1ccc([N+](=O)[O-])c(O)c1.Cc1cccc([N+](=O)[O-])c1O.O=[N+]([O-])c1ccccc1O |
| InChI | InChI=1S/2C7H7NO3.C6H5NO3/c1-5-2-3-6(8(10)11)7(9)4-5;1-5-3-2-4-6(7(5)9)8(10)11;8-6-4-2-1-3-5(6)7(9)10/h2*2-4,9H,1H3;1-4,8H |
| InChIKey | UHUTWLXJNGTGNA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol?
The IUPAC name of 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol (CID 161096092) is 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol.
What is the SMILES notation for 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol?
The canonical SMILES for 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol is Cc1ccc([N+](=O)[O-])c(O)c1.Cc1cccc([N+](=O)[O-])c1O.O=[N+]([O-])c1ccccc1O.
What is the InChIKey of 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol?
The InChIKey is UHUTWLXJNGTGNA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7NO3.C6H5NO3/c1-5-2-3-6(8(10)11)7(9)4-5;1-5-3-2-4-6(7(5)9)8(10)11;8-6-4-2-1-3-5(6)7(9)10/h2*2-4,9H,1H3;1-4,8H.
What are the key properties of 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol?
2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol has a molecular weight of 445.38 g/mol, XLogP of 4.52, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-nitrophenol;5-methyl-2-nitrophenol;2-nitrophenol is sourced from PubChem (CID 161096092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).