About 4-methyl-2-nitrophenol;4-methylphenol
4-methyl-2-nitrophenol;4-methylphenol (PubChem CID 21439085) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-methyl-2-nitrophenol;4-methylphenol.
Molecular Properties
| Compound Name | 4-methyl-2-nitrophenol;4-methylphenol |
| PubChem CID | 21439085 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-methyl-2-nitrophenol;4-methylphenol |
| SMILES | Cc1ccc(O)c([N+](=O)[O-])c1.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H7NO3.C7H8O/c1-5-2-3-7(9)6(4-5)8(10)11;1-6-2-4-7(8)5-3-6/h2-4,9H,1H3;2-5,8H,1H3 |
| InChIKey | MWLXIKBLGQUCHP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-nitrophenol;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-nitrophenol;4-methylphenol?
The IUPAC name of 4-methyl-2-nitrophenol;4-methylphenol (CID 21439085) is 4-methyl-2-nitrophenol;4-methylphenol.
What is the SMILES notation for 4-methyl-2-nitrophenol;4-methylphenol?
The canonical SMILES for 4-methyl-2-nitrophenol;4-methylphenol is Cc1ccc(O)c([N+](=O)[O-])c1.Cc1ccc(O)cc1.
What is the InChIKey of 4-methyl-2-nitrophenol;4-methylphenol?
The InChIKey is MWLXIKBLGQUCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.C7H8O/c1-5-2-3-7(9)6(4-5)8(10)11;1-6-2-4-7(8)5-3-6/h2-4,9H,1H3;2-5,8H,1H3.
What are the key properties of 4-methyl-2-nitrophenol;4-methylphenol?
4-methyl-2-nitrophenol;4-methylphenol has a molecular weight of 261.28 g/mol, XLogP of 3.31, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-nitrophenol;4-methylphenol is sourced from PubChem (CID 21439085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).