C12H10N2O8 — CID 162059656
2-nitrobenzene-1,3-diol;2-nitrobenzene-1,4-diol (PubChem CID 162059656) has the molecular formula C12H10N2O8 and a molecular weight of 310.22 g/mol. Its IUPAC name is 2-nitrobenzene-1,3-diol;2-nitrobenzene-1,4-diol.
| Compound Name | 2-nitrobenzene-1,3-diol;2-nitrobenzene-1,4-diol |
|---|---|
| PubChem CID | 162059656 |
| Molecular Formula | C12H10N2O8 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-nitrobenzene-1,3-diol;2-nitrobenzene-1,4-diol |
| SMILES | O=[N+]([O-])c1c(O)cccc1O.O=[N+]([O-])c1cc(O)ccc1O |
| InChI | InChI=1S/2C6H5NO4/c8-4-1-2-6(9)5(3-4)7(10)11;8-4-2-1-3-5(9)6(4)7(10)11/h2*1-3,8-9H |
| InChIKey | YZQUGAKXEJSGNP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|