C40H37BrN4O — CID 135710937
(1Z)-1-[20-bromo-17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol (PubChem CID 135710937) has the molecular formula C40H37BrN4O and a molecular weight of 669.67 g/mol. Its IUPAC name is (1Z)-1-[20-bromo-17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol.
| Compound Name | (1Z)-1-[20-bromo-17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol |
|---|---|
| PubChem CID | 135710937 |
| Molecular Formula | C40H37BrN4O |
| Molecular Weight | 669.67 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | (1Z)-1-[20-bromo-17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol |
| SMILES | C/C(O)=C1\C=C2N=C1/C(Br)=C1/CC(C)(C)/C(=C/C3=N/C(=C(/c4ccc(C)cc4)C4=N/C(=C\2c2c(C)cc(C)cc2C)C=C4)C=C3)N1 |
| InChI | InChI=1S/C40H37BrN4O/c1-21-8-10-26(11-9-21)36-29-13-12-27(42-29)18-34-40(6,7)20-33(44-34)38(41)39-28(25(5)46)19-32(45-39)37(31-15-14-30(36)43-31)35-23(3)16-22(2)17-24(35)4/h8-19,44,46H,20H2,1-7H3/b28-25-,34-18-,36-29-,37-31+,38-33+ |
| InChIKey | HVGIAEFHPKSZNB-ROSSNOSKSA-N |
| XLogP | 9.76 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.67 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|