C30H26N4O — CID 135846005
(Z)-[13,13-dimethyl-5-(4-methylphenyl)-12,23-dihydroporphyrin-2-ylidene]methanol (PubChem CID 135846005) has the molecular formula C30H26N4O and a molecular weight of 458.57 g/mol. Its IUPAC name is (Z)-[13,13-dimethyl-5-(4-methylphenyl)-12,23-dihydroporphyrin-2-ylidene]methanol.
| Compound Name | (Z)-[13,13-dimethyl-5-(4-methylphenyl)-12,23-dihydroporphyrin-2-ylidene]methanol |
|---|---|
| PubChem CID | 135846005 |
| Molecular Formula | C30H26N4O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (Z)-[13,13-dimethyl-5-(4-methylphenyl)-12,23-dihydroporphyrin-2-ylidene]methanol |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C=C3/CC(C)(C)/C(=C/C4=N/C(=C\C5=NC2=C/C5=C/O)C=C4)N3)cc1 |
| InChI | InChI=1S/C30H26N4O/c1-18-4-6-19(7-5-18)29-25-11-10-21(32-25)13-24-16-30(2,3)28(33-24)15-23-9-8-22(31-23)14-26-20(17-35)12-27(29)34-26/h4-15,17,33,35H,16H2,1-3H3/b20-17-,22-14-,24-13-,28-15-,29-25- |
| InChIKey | HPBVNPYHXOCEKI-HQDRQZFUSA-N |
| XLogP | 6.19 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|