C31H26N4OZn — CID 23628973
zinc (1Z)-1-[13,13-dimethyl-5-(4-methylphenyl)-12H-porphyrin-21-id-2-ylidene]ethanolate (PubChem CID 23628973) has the molecular formula C31H26N4OZn and a molecular weight of 535.97 g/mol. Its IUPAC name is zinc (1Z)-1-[13,13-dimethyl-5-(4-methylphenyl)-12H-porphyrin-21-id-2-ylidene]ethanolate.
| Compound Name | zinc (1Z)-1-[13,13-dimethyl-5-(4-methylphenyl)-12H-porphyrin-21-id-2-ylidene]ethanolate |
|---|---|
| PubChem CID | 23628973 |
| Molecular Formula | C31H26N4OZn |
| Molecular Weight | 535.97 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | zinc (1Z)-1-[13,13-dimethyl-5-(4-methylphenyl)-12H-porphyrin-21-id-2-ylidene]ethanolate |
| SMILES | C/C([O-])=c1\cc2[n-]\c1=C/C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2c2ccc(C)cc2)C=C4)CC3(C)C)C=C1.[Zn+2] |
| InChI | InChI=1S/C31H27N4O.Zn/c1-18-5-7-20(8-6-18)30-26-12-11-21(33-26)13-24-17-31(3,4)29(34-24)15-23-10-9-22(32-23)14-27-25(19(2)36)16-28(30)35-27;/h5-16H,17H2,1-4H3,(H-,32,33,34,35,36);/q-1;+2/p-1 |
| InChIKey | VNMJBNGLKVBWRH-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 74.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|