C42H40N4O — CID 136721272
21,21-dimethyl-9,14-bis(2,4,6-trimethylphenyl)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,4,6,8(26),9,11,13(25),14,16,18(24),19-undecaen-4-ol (PubChem CID 136721272) has the molecular formula C42H40N4O and a molecular weight of 616.81 g/mol. Its IUPAC name is 21,21-dimethyl-9,14-bis(2,4,6-trimethylphenyl)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,4,6,8(26),9,11,13(25),14,16,18(24),19-undecaen-4-ol.
| Compound Name | 21,21-dimethyl-9,14-bis(2,4,6-trimethylphenyl)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,4,6,8(26),9,11,13(25),14,16,18(24),19-undecaen-4-ol |
|---|---|
| PubChem CID | 136721272 |
| Molecular Formula | C42H40N4O |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | 21,21-dimethyl-9,14-bis(2,4,6-trimethylphenyl)-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,4,6,8(26),9,11,13(25),14,16,18(24),19-undecaen-4-ol |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC(=N3)/C=C3\N/C(=C4/CC(O)=C5C=C2N=C54)CC3(C)C)c(C)c1 |
| InChI | InChI=1S/C42H40N4O/c1-21-13-23(3)37(24(4)14-21)39-30-10-9-27(43-30)17-36-42(7,8)20-34(45-36)28-19-35(47)29-18-33(46-41(28)29)40(32-12-11-31(39)44-32)38-25(5)15-22(2)16-26(38)6/h9-18,45,47H,19-20H2,1-8H3/b34-28-,36-17-,39-30+,40-32+ |
| InChIKey | BPSWZOXCBSSXIT-CTUKRDNESA-N |
| XLogP | 9.41 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |