C46H44N4O4 — CID 67361588
4-[3-(4-carboxyphenyl)-5,10-dihexylporphyrin-2-yl]benzoic acid (PubChem CID 67361588) has the molecular formula C46H44N4O4 and a molecular weight of 716.88 g/mol. Its IUPAC name is 4-[3-(4-carboxyphenyl)-5,10-dihexylporphyrin-2-yl]benzoic acid.
| Compound Name | 4-[3-(4-carboxyphenyl)-5,10-dihexylporphyrin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 67361588 |
| Molecular Formula | C46H44N4O4 |
| Molecular Weight | 716.88 g/mol |
| Exact Mass | 716.34 |
| IUPAC Name | 4-[3-(4-carboxyphenyl)-5,10-dihexylporphyrin-2-yl]benzoic acid |
| SMILES | CCCCCC/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C=C2\N=C(C(c3ccc(C(=O)O)cc3)=C2c2ccc(C(=O)O)cc2)/C(CCCCCC)=C2/C=CC1=N2 |
| InChI | InChI=1S/C46H44N4O4/c1-3-5-7-9-11-36-38-24-23-34(48-38)27-33-21-22-35(47-33)28-41-42(29-13-17-31(18-14-29)45(51)52)43(30-15-19-32(20-16-30)46(53)54)44(50-41)37(12-10-8-6-4-2)40-26-25-39(36)49-40/h13-28H,3-12H2,1-2H3,(H,51,52)(H,53,54)/b33-27-,34-27-,35-28-,38-36-,39-36-,40-37-,41-28-,44-37- |
| InChIKey | OKXMFDCCCPXVDB-XURBZXKTSA-N |
| XLogP | 10.71 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.88 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|