C84H72N4O8 — CID 90839175
[4-[10,15,20-tris[4-(3,4,5-trimethylbenzoyl)oxyphenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl] 3,4,5-trimethylbenzoate (PubChem CID 90839175) has the molecular formula C84H72N4O8 and a molecular weight of 1265.52 g/mol. Its IUPAC name is [4-[10,15,20-tris[4-(3,4,5-trimethylbenzoyl)oxyphenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl] 3,4,5-trimethylbenzoate.
| Compound Name | [4-[10,15,20-tris[4-(3,4,5-trimethylbenzoyl)oxyphenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl] 3,4,5-trimethylbenzoate |
|---|---|
| PubChem CID | 90839175 |
| Molecular Formula | C84H72N4O8 |
| Molecular Weight | 1265.52 g/mol |
| Exact Mass | 1264.54 |
| IUPAC Name | [4-[10,15,20-tris[4-(3,4,5-trimethylbenzoyl)oxyphenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl] 3,4,5-trimethylbenzoate |
| SMILES | Cc1cc(C(=O)Oc2ccc(C3=c4ccc([nH]4)=C(c4ccc(OC(=O)c5cc(C)c(C)c(C)c5)cc4)c4ccc([nH]4)C(c4ccc(OC(=O)c5cc(C)c(C)c(C)c5)cc4)=c4ccc([nH]4)=C(c4ccc(OC(=O)c5cc(C)c(C)c(C)c5)cc4)c4ccc3[nH]4)cc2)cc(C)c1C |
| InChI | InChI=1S/C84H72N4O8/c1-45-37-61(38-46(2)53(45)9)81(89)93-65-21-13-57(14-22-65)77-69-29-31-71(85-69)78(58-15-23-66(24-16-58)94-82(90)62-39-47(3)54(10)48(4)40-62)73-33-35-75(87-73)80(60-19-27-68(28-20-60)96-84(92)64-43-51(7)56(12)52(8)44-64)76-36-34-74(88-76)79(72-32-30-70(77)86-72)59-17-25-67(26-18-59)95-83(91)63-41-49(5)55(11)50(6)42-63/h13-44,85-88H,1-12H3 |
| InChIKey | DFKUKIVNZFAVEP-UHFFFAOYSA-N |
| XLogP | 14.88 |
| TPSA | 168.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1265.52 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|