C36H36O6 — CID 54311853
[3,5-bis[(3,4,5-trimethylbenzoyl)oxy]phenyl] 3,4,5-trimethylbenzoate (PubChem CID 54311853) has the molecular formula C36H36O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is [3,5-bis[(3,4,5-trimethylbenzoyl)oxy]phenyl] 3,4,5-trimethylbenzoate.
| Compound Name | [3,5-bis[(3,4,5-trimethylbenzoyl)oxy]phenyl] 3,4,5-trimethylbenzoate |
|---|---|
| PubChem CID | 54311853 |
| Molecular Formula | C36H36O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | [3,5-bis[(3,4,5-trimethylbenzoyl)oxy]phenyl] 3,4,5-trimethylbenzoate |
| SMILES | Cc1cc(C(=O)Oc2cc(OC(=O)c3cc(C)c(C)c(C)c3)cc(OC(=O)c3cc(C)c(C)c(C)c3)c2)cc(C)c1C |
| InChI | InChI=1S/C36H36O6/c1-19-10-28(11-20(2)25(19)7)34(37)40-31-16-32(41-35(38)29-12-21(3)26(8)22(4)13-29)18-33(17-31)42-36(39)30-14-23(5)27(9)24(6)15-30/h10-18H,1-9H3 |
| InChIKey | SLLMOUXSFHTMMW-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|