C52H38F10IN4O3P — CID 90831674
5-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenyl]-15-(4-iodophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 90831674) has the molecular formula C52H38F10IN4O3P and a molecular weight of 1114.76 g/mol. Its IUPAC name is 5-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenyl]-15-(4-iodophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenyl]-15-(4-iodophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90831674 |
| Molecular Formula | C52H38F10IN4O3P |
| Molecular Weight | 1114.76 g/mol |
| Exact Mass | 1114.16 |
| IUPAC Name | 5-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenyl]-15-(4-iodophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | CC(C)(C)OP(=O)(OC(C)(C)C)c1ccc(C2=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc([nH]3)C(c3ccc(I)cc3)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C52H38F10IN4O3P/c1-51(2,3)69-71(68,70-52(4,5)6)26-13-9-24(10-14-26)36-29-17-21-33(66-29)37(39-41(53)45(57)49(61)46(58)42(39)54)31-19-15-27(64-31)35(23-7-11-25(63)12-8-23)28-16-20-32(65-28)38(34-22-18-30(36)67-34)40-43(55)47(59)50(62)48(60)44(40)56/h7-22,64-67H,1-6H3 |
| InChIKey | GWAYFRJVVAKFEG-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.76 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|