C17H20F9NO7S3 — CID 126552940
[4-(5-methylhexan-3-yl)phenyl] 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate (PubChem CID 126552940) has the molecular formula C17H20F9NO7S3 and a molecular weight of 617.53 g/mol. Its IUPAC name is [4-(5-methylhexan-3-yl)phenyl] 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate.
| Compound Name | [4-(5-methylhexan-3-yl)phenyl] 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 126552940 |
| Molecular Formula | C17H20F9NO7S3 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 617.03 |
| IUPAC Name | [4-(5-methylhexan-3-yl)phenyl] 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate |
| SMILES | CCC(CC(C)C)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H20F9NO7S3/c1-4-11(9-10(2)3)12-5-7-13(8-6-12)34-37(32,33)16(22,23)14(18,19)15(20,21)35(28,29)27-36(30,31)17(24,25)26/h5-8,10-11,27H,4,9H2,1-3H3 |
| InChIKey | HKWBFGIXUMZLEZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|