C15H19F6NO8S3 — CID 58363951
(4-butan-2-ylphenoxy)methyl 1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propane-1-sulfonate (PubChem CID 58363951) has the molecular formula C15H19F6NO8S3 and a molecular weight of 551.51 g/mol. Its IUPAC name is (4-butan-2-ylphenoxy)methyl 1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propane-1-sulfonate.
| Compound Name | (4-butan-2-ylphenoxy)methyl 1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 58363951 |
| Molecular Formula | C15H19F6NO8S3 |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | (4-butan-2-ylphenoxy)methyl 1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propane-1-sulfonate |
| SMILES | CCC(C)c1ccc(OCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H19F6NO8S3/c1-4-10(2)11-5-7-12(8-6-11)29-9-30-33(27,28)15(20,21)13(16,17)14(18,19)32(25,26)22-31(3,23)24/h5-8,10,22H,4,9H2,1-3H3 |
| InChIKey | KXRINSSUXKHHFL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|