C16H16F6O8S2 — CID 58363938
1,1,2,2,3,3-hexafluoro-3-[4-(4-methyl-3-oxohexanoyl)phenoxy]sulfonylpropane-1-sulfonic acid (PubChem CID 58363938) has the molecular formula C16H16F6O8S2 and a molecular weight of 514.42 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-(4-methyl-3-oxohexanoyl)phenoxy]sulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-(4-methyl-3-oxohexanoyl)phenoxy]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58363938 |
| Molecular Formula | C16H16F6O8S2 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-(4-methyl-3-oxohexanoyl)phenoxy]sulfonylpropane-1-sulfonic acid |
| SMILES | CCC(C)C(=O)CC(=O)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H16F6O8S2/c1-3-9(2)12(23)8-13(24)10-4-6-11(7-5-10)30-32(28,29)16(21,22)14(17,18)15(19,20)31(25,26)27/h4-7,9H,3,8H2,1-2H3,(H,25,26,27) |
| InChIKey | OFDPIDNZIBFVQB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|