C21H27F6NO8S2 — CID 122682417
[3-[2-[4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonyloxyphenyl]ethylamino]-3-oxopropyl] 2-methylbutanoate (PubChem CID 122682417) has the molecular formula C21H27F6NO8S2 and a molecular weight of 599.57 g/mol. Its IUPAC name is [3-[2-[4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonyloxyphenyl]ethylamino]-3-oxopropyl] 2-methylbutanoate.
| Compound Name | [3-[2-[4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonyloxyphenyl]ethylamino]-3-oxopropyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 122682417 |
| Molecular Formula | C21H27F6NO8S2 |
| Molecular Weight | 599.57 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | [3-[2-[4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonyloxyphenyl]ethylamino]-3-oxopropyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCC(=O)NCCc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C21H27F6NO8S2/c1-4-14(3)18(30)35-13-11-17(29)28-12-10-15-6-8-16(9-7-15)36-38(33,34)21(26,27)19(22,23)20(24,25)37(31,32)5-2/h6-9,14H,4-5,10-13H2,1-3H3,(H,28,29) |
| InChIKey | DTASWMVHHLGOGT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|