C20H25F6NO11S3 — CID 118638189
4-(2-methylbutanoyloxy)butyl 4-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate (PubChem CID 118638189) has the molecular formula C20H25F6NO11S3 and a molecular weight of 665.61 g/mol. Its IUPAC name is 4-(2-methylbutanoyloxy)butyl 4-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate.
| Compound Name | 4-(2-methylbutanoyloxy)butyl 4-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate |
|---|---|
| PubChem CID | 118638189 |
| Molecular Formula | C20H25F6NO11S3 |
| Molecular Weight | 665.61 g/mol |
| Exact Mass | 665.05 |
| IUPAC Name | 4-(2-methylbutanoyloxy)butyl 4-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate |
| SMILES | CCC(C)C(=O)OCCCCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25F6NO11S3/c1-4-13(2)16(28)36-11-5-6-12-37-17(29)14-7-9-15(10-8-14)38-41(34,35)20(25,26)18(21,22)19(23,24)40(32,33)27-39(3,30)31/h7-10,13,27H,4-6,11-12H2,1-3H3 |
| InChIKey | DBHAQLUELIHWAF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 176.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|