C12H10F3NO3S — CID 82715252
N-(2,2,2-trifluoroethoxy)naphthalene-2-sulfonamide (PubChem CID 82715252) has the molecular formula C12H10F3NO3S and a molecular weight of 305.28 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethoxy)naphthalene-2-sulfonamide.
| Compound Name | N-(2,2,2-trifluoroethoxy)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 82715252 |
| Molecular Formula | C12H10F3NO3S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-(2,2,2-trifluoroethoxy)naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NOCC(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10F3NO3S/c13-12(14,15)8-19-16-20(17,18)11-6-5-9-3-1-2-4-10(9)7-11/h1-7,16H,8H2 |
| InChIKey | JIOXBZBAJSQFLX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|