C16H11F3N2O2S — CID 167877527
N-[3-(trifluoromethyl)-2-pyridinyl]naphthalene-2-sulfonamide (PubChem CID 167877527) has the molecular formula C16H11F3N2O2S and a molecular weight of 352.34 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)-2-pyridinyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-(trifluoromethyl)-2-pyridinyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 167877527 |
| Molecular Formula | C16H11F3N2O2S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-[3-(trifluoromethyl)-2-pyridinyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ncccc1C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H11F3N2O2S/c17-16(18,19)14-6-3-9-20-15(14)21-24(22,23)13-8-7-11-4-1-2-5-12(11)10-13/h1-10H,(H,20,21) |
| InChIKey | WONOSVXAZBRSRG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |