C22H18N4O3S — CID 126474142
N-[3-[3-(naphthalen-2-ylsulfonylamino)pyrazin-2-yl]phenyl]acetamide (PubChem CID 126474142) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[3-[3-(naphthalen-2-ylsulfonylamino)pyrazin-2-yl]phenyl]acetamide.
| Compound Name | N-[3-[3-(naphthalen-2-ylsulfonylamino)pyrazin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 126474142 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[3-[3-(naphthalen-2-ylsulfonylamino)pyrazin-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2nccnc2NS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C22H18N4O3S/c1-15(27)25-19-8-4-7-18(13-19)21-22(24-12-11-23-21)26-30(28,29)20-10-9-16-5-2-3-6-17(16)14-20/h2-14H,1H3,(H,24,26)(H,25,27) |
| InChIKey | HJLSYDJYWOHWGU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |