C11H17NO5S2 — CID 55161344
3-amino-2-[2,4-bis(methylsulfonyl)phenyl]propan-1-ol (PubChem CID 55161344) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-amino-2-[2,4-bis(methylsulfonyl)phenyl]propan-1-ol.
| Compound Name | 3-amino-2-[2,4-bis(methylsulfonyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 55161344 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-amino-2-[2,4-bis(methylsulfonyl)phenyl]propan-1-ol |
| SMILES | CS(=O)(=O)c1ccc(C(CN)CO)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H17NO5S2/c1-18(14,15)9-3-4-10(8(6-12)7-13)11(5-9)19(2,16)17/h3-5,8,13H,6-7,12H2,1-2H3 |
| InChIKey | BYTAITPOBLIAJV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |