C14H20O5S2 — CID 63196753
3-[2,4-bis(methylsulfonyl)phenyl]-4-methylpentan-2-one (PubChem CID 63196753) has the molecular formula C14H20O5S2 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-[2,4-bis(methylsulfonyl)phenyl]-4-methylpentan-2-one.
| Compound Name | 3-[2,4-bis(methylsulfonyl)phenyl]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 63196753 |
| Molecular Formula | C14H20O5S2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-[2,4-bis(methylsulfonyl)phenyl]-4-methylpentan-2-one |
| SMILES | CC(=O)C(c1ccc(S(C)(=O)=O)cc1S(C)(=O)=O)C(C)C |
| InChI | InChI=1S/C14H20O5S2/c1-9(2)14(10(3)15)12-7-6-11(20(4,16)17)8-13(12)21(5,18)19/h6-9,14H,1-5H3 |
| InChIKey | KRMNMGQMLANOPG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |