C13H19ClO4S2 — CID 63203249
1-(2-chloro-3-methylbutyl)-2,4-bis(methylsulfonyl)benzene (PubChem CID 63203249) has the molecular formula C13H19ClO4S2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 1-(2-chloro-3-methylbutyl)-2,4-bis(methylsulfonyl)benzene.
| Compound Name | 1-(2-chloro-3-methylbutyl)-2,4-bis(methylsulfonyl)benzene |
|---|---|
| PubChem CID | 63203249 |
| Molecular Formula | C13H19ClO4S2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-(2-chloro-3-methylbutyl)-2,4-bis(methylsulfonyl)benzene |
| SMILES | CC(C)C(Cl)Cc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C13H19ClO4S2/c1-9(2)12(14)7-10-5-6-11(19(3,15)16)8-13(10)20(4,17)18/h5-6,8-9,12H,7H2,1-4H3 |
| InChIKey | KIDKAAISDPNVJB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|