C10H9BrFNO2S — CID 170466747
4-(4-bromobut-1-ynyl)-3-fluorobenzenesulfonamide (PubChem CID 170466747) has the molecular formula C10H9BrFNO2S and a molecular weight of 306.16 g/mol. Its IUPAC name is 4-(4-bromobut-1-ynyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-(4-bromobut-1-ynyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 170466747 |
| Molecular Formula | C10H9BrFNO2S |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | 4-(4-bromobut-1-ynyl)-3-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C#CCCBr)c(F)c1 |
| InChI | InChI=1S/C10H9BrFNO2S/c11-6-2-1-3-8-4-5-9(7-10(8)12)16(13,14)15/h4-5,7H,2,6H2,(H2,13,14,15) |
| InChIKey | ZLJJGXZGRLCOHZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|