C14H17FN2O2S — CID 107652358
3-(2-fluoro-4-piperidin-1-ylsulfonylphenyl)prop-2-yn-1-amine (PubChem CID 107652358) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-(2-fluoro-4-piperidin-1-ylsulfonylphenyl)prop-2-yn-1-amine.
| Compound Name | 3-(2-fluoro-4-piperidin-1-ylsulfonylphenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 107652358 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-(2-fluoro-4-piperidin-1-ylsulfonylphenyl)prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccc(S(=O)(=O)N2CCCCC2)cc1F |
| InChI | InChI=1S/C14H17FN2O2S/c15-14-11-13(7-6-12(14)5-4-8-16)20(18,19)17-9-2-1-3-10-17/h6-7,11H,1-3,8-10,16H2 |
| InChIKey | ISQBNUFCMAXAPJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|