C13H14FN3O3S — CID 106197583
4-(3-aminoprop-1-ynyl)-3-fluoro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide (PubChem CID 106197583) has the molecular formula C13H14FN3O3S and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106197583 |
| Molecular Formula | C13H14FN3O3S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
| SMILES | NCC#Cc1ccc(S(=O)(=O)NC2CNC(=O)C2)cc1F |
| InChI | InChI=1S/C13H14FN3O3S/c14-12-7-11(4-3-9(12)2-1-5-15)21(19,20)17-10-6-13(18)16-8-10/h3-4,7,10,17H,5-6,8,15H2,(H,16,18) |
| InChIKey | XYEREAZKPCYWQF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|