C10H12N4O5S — CID 106197698
3-amino-4-nitro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide (PubChem CID 106197698) has the molecular formula C10H12N4O5S and a molecular weight of 300.30 g/mol. Its IUPAC name is 3-amino-4-nitro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-nitro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106197698 |
| Molecular Formula | C10H12N4O5S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-amino-4-nitro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NC2CNC(=O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N4O5S/c11-8-4-7(1-2-9(8)14(16)17)20(18,19)13-6-3-10(15)12-5-6/h1-2,4,6,13H,3,5,11H2,(H,12,15) |
| InChIKey | UXQPRPIWDIHFGF-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|