C12H17N3O3S — CID 106181011
5-amino-2,3-dimethyl-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide (PubChem CID 106181011) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 5-amino-2,3-dimethyl-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-2,3-dimethyl-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106181011 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 5-amino-2,3-dimethyl-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)NC2CNC(=O)C2)c1C |
| InChI | InChI=1S/C12H17N3O3S/c1-7-3-9(13)4-11(8(7)2)19(17,18)15-10-5-12(16)14-6-10/h3-4,10,15H,5-6,13H2,1-2H3,(H,14,16) |
| InChIKey | LTZXKTSVTISRDG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|