C10H6BrF2NO2 — CID 170466752
1-(4-bromobut-1-ynyl)-3,5-difluoro-2-nitrobenzene (PubChem CID 170466752) has the molecular formula C10H6BrF2NO2 and a molecular weight of 290.06 g/mol. Its IUPAC name is 1-(4-bromobut-1-ynyl)-3,5-difluoro-2-nitrobenzene.
| Compound Name | 1-(4-bromobut-1-ynyl)-3,5-difluoro-2-nitrobenzene |
|---|---|
| PubChem CID | 170466752 |
| Molecular Formula | C10H6BrF2NO2 |
| Molecular Weight | 290.06 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | 1-(4-bromobut-1-ynyl)-3,5-difluoro-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(F)cc(F)cc1C#CCCBr |
| InChI | InChI=1S/C10H6BrF2NO2/c11-4-2-1-3-7-5-8(12)6-9(13)10(7)14(15)16/h5-6H,2,4H2 |
| InChIKey | HXVOTQBIUKQJLI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.06 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|